C22H34O4 — CID 146682221
(1S,5R,6S)-5-hydroxy-1-(11-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl)-4-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 146682221) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (1S,5R,6S)-5-hydroxy-1-(11-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl)-4-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1S,5R,6S)-5-hydroxy-1-(11-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl)-4-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 146682221 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (1S,5R,6S)-5-hydroxy-1-(11-hydroxy-3,7,11-trimethyldodeca-2,6-dienyl)-4-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | CC(=CC[C@]12O[C@H]1[C@H](O)C(C)=CC2=O)CCC=C(C)CCCC(C)(C)O |
| InChI | InChI=1S/C22H34O4/c1-15(10-7-12-21(4,5)25)8-6-9-16(2)11-13-22-18(23)14-17(3)19(24)20(22)26-22/h8,11,14,19-20,24-25H,6-7,9-10,12-13H2,1-5H3/t19-,20+,22-/m1/s1 |
| InChIKey | NERQZCKFIOERIY-RZUBCFFCSA-N |
| XLogP | 4.02 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|