C22H34O5 — CID 146682222
(1S,5R,6S)-1-(10,11-dihydroxy-3,7,11-trimethyldodeca-2,6-dienyl)-5-hydroxy-4-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 146682222) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is (1S,5R,6S)-1-(10,11-dihydroxy-3,7,11-trimethyldodeca-2,6-dienyl)-5-hydroxy-4-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1S,5R,6S)-1-(10,11-dihydroxy-3,7,11-trimethyldodeca-2,6-dienyl)-5-hydroxy-4-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 146682222 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (1S,5R,6S)-1-(10,11-dihydroxy-3,7,11-trimethyldodeca-2,6-dienyl)-5-hydroxy-4-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | CC(=CC[C@]12O[C@H]1[C@H](O)C(C)=CC2=O)CCC=C(C)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C22H34O5/c1-14(9-10-17(23)21(4,5)26)7-6-8-15(2)11-12-22-18(24)13-16(3)19(25)20(22)27-22/h7,11,13,17,19-20,23,25-26H,6,8-10,12H2,1-5H3/t17?,19-,20+,22-/m1/s1 |
| InChIKey | SQKDOTYACJMOID-UXGKSEPASA-N |
| XLogP | 2.99 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|