C16H24O5 — CID 146682247
(6R,7S,8S)-6,7,8-trihydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)-3,5,6,7-tetrahydrochromen-4-one (PubChem CID 146682247) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is (6R,7S,8S)-6,7,8-trihydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)-3,5,6,7-tetrahydrochromen-4-one.
| Compound Name | (6R,7S,8S)-6,7,8-trihydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)-3,5,6,7-tetrahydrochromen-4-one |
|---|---|
| PubChem CID | 146682247 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (6R,7S,8S)-6,7,8-trihydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)-3,5,6,7-tetrahydrochromen-4-one |
| SMILES | CC(C)=CC[C@@]1(O)C2=C(C[C@@H](O)[C@@H]1O)C(=O)CC(C)(C)O2 |
| InChI | InChI=1S/C16H24O5/c1-9(2)5-6-16(20)13(19)11(17)7-10-12(18)8-15(3,4)21-14(10)16/h5,11,13,17,19-20H,6-8H2,1-4H3/t11-,13+,16+/m1/s1 |
| InChIKey | SSMYUFFFSWBFFU-FFSVYQOJSA-N |
| XLogP | 1.22 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|