C24H30O5 — CID 146682297
13-[(2R,3S)-4-hydroxy-3,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]-3,5,7-trimethyltetradeca-2,4,6,8,10,12-hexaenoic acid (PubChem CID 146682297) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is 13-[(2R,3S)-4-hydroxy-3,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]-3,5,7-trimethyltetradeca-2,4,6,8,10,12-hexaenoic acid.
| Compound Name | 13-[(2R,3S)-4-hydroxy-3,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]-3,5,7-trimethyltetradeca-2,4,6,8,10,12-hexaenoic acid |
|---|---|
| PubChem CID | 146682297 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 13-[(2R,3S)-4-hydroxy-3,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]-3,5,7-trimethyltetradeca-2,4,6,8,10,12-hexaenoic acid |
| SMILES | CC(=CC(=O)O)C=C(C)C=C(C)C=CC=CC=C(C)[C@@H]1OC(=O)C(C)=C(O)[C@H]1C |
| InChI | InChI=1S/C24H30O5/c1-15(12-16(2)13-17(3)14-21(25)26)10-8-7-9-11-18(4)23-19(5)22(27)20(6)24(28)29-23/h7-14,19,23,27H,1-6H3,(H,25,26)/t19-,23+/m1/s1 |
| InChIKey | PZEYJJNSSWZZBI-XXBNENTESA-N |
| XLogP | 5.36 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|