C25H32O5 — CID 146682298
13-[(2S)-4-hydroxy-3,3,5-trimethyl-6-oxo-2H-pyran-2-yl]-3,5,7-trimethyltetradeca-2,4,6,8,10,12-hexaenoic acid (PubChem CID 146682298) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is 13-[(2S)-4-hydroxy-3,3,5-trimethyl-6-oxo-2H-pyran-2-yl]-3,5,7-trimethyltetradeca-2,4,6,8,10,12-hexaenoic acid.
| Compound Name | 13-[(2S)-4-hydroxy-3,3,5-trimethyl-6-oxo-2H-pyran-2-yl]-3,5,7-trimethyltetradeca-2,4,6,8,10,12-hexaenoic acid |
|---|---|
| PubChem CID | 146682298 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 13-[(2S)-4-hydroxy-3,3,5-trimethyl-6-oxo-2H-pyran-2-yl]-3,5,7-trimethyltetradeca-2,4,6,8,10,12-hexaenoic acid |
| SMILES | CC(=CC(=O)O)C=C(C)C=C(C)C=CC=CC=C(C)[C@@H]1OC(=O)C(C)=C(O)C1(C)C |
| InChI | InChI=1S/C25H32O5/c1-16(13-17(2)14-18(3)15-21(26)27)11-9-8-10-12-19(4)23-25(6,7)22(28)20(5)24(29)30-23/h8-15,23,28H,1-7H3,(H,26,27)/t23-/m0/s1 |
| InChIKey | KMLFNHCEOOZYJG-QHCPKHFHSA-N |
| XLogP | 5.75 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|