C21H26O6 — CID 146682400
(2R,4aR,6S)-2-[2-(2,5-dihydroxyphenyl)-2-oxoethyl]-6-hydroxy-5,5-dimethyl-1,3,4,4a,6,7-hexahydronaphthalene-2-carboxylic acid (PubChem CID 146682400) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is (2R,4aR,6S)-2-[2-(2,5-dihydroxyphenyl)-2-oxoethyl]-6-hydroxy-5,5-dimethyl-1,3,4,4a,6,7-hexahydronaphthalene-2-carboxylic acid.
| Compound Name | (2R,4aR,6S)-2-[2-(2,5-dihydroxyphenyl)-2-oxoethyl]-6-hydroxy-5,5-dimethyl-1,3,4,4a,6,7-hexahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 146682400 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (2R,4aR,6S)-2-[2-(2,5-dihydroxyphenyl)-2-oxoethyl]-6-hydroxy-5,5-dimethyl-1,3,4,4a,6,7-hexahydronaphthalene-2-carboxylic acid |
| SMILES | CC1(C)[C@@H]2CC[C@@](CC(=O)c3cc(O)ccc3O)(C(=O)O)CC2=CC[C@@H]1O |
| InChI | InChI=1S/C21H26O6/c1-20(2)15-7-8-21(19(26)27,10-12(15)3-6-18(20)25)11-17(24)14-9-13(22)4-5-16(14)23/h3-5,9,15,18,22-23,25H,6-8,10-11H2,1-2H3,(H,26,27)/t15-,18+,21-/m1/s1 |
| InChIKey | VRNLFGHQVVPEKR-FYINFDKHSA-N |
| XLogP | 3.26 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|