C15H26O4 — CID 146682414
(1S,3R,3aS,6R,8S,8aS)-8-(hydroxymethyl)-3-methyl-5-propan-2-yl-2,3,3a,6,7,8a-hexahydro-1H-azulene-1,6,8-triol (PubChem CID 146682414) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1S,3R,3aS,6R,8S,8aS)-8-(hydroxymethyl)-3-methyl-5-propan-2-yl-2,3,3a,6,7,8a-hexahydro-1H-azulene-1,6,8-triol.
| Compound Name | (1S,3R,3aS,6R,8S,8aS)-8-(hydroxymethyl)-3-methyl-5-propan-2-yl-2,3,3a,6,7,8a-hexahydro-1H-azulene-1,6,8-triol |
|---|---|
| PubChem CID | 146682414 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (1S,3R,3aS,6R,8S,8aS)-8-(hydroxymethyl)-3-methyl-5-propan-2-yl-2,3,3a,6,7,8a-hexahydro-1H-azulene-1,6,8-triol |
| SMILES | CC(C)C1=C[C@H]2[C@@H]([C@@H](O)C[C@H]2C)[C@](O)(CO)C[C@H]1O |
| InChI | InChI=1S/C15H26O4/c1-8(2)10-5-11-9(3)4-12(17)14(11)15(19,7-16)6-13(10)18/h5,8-9,11-14,16-19H,4,6-7H2,1-3H3/t9-,11-,12+,13-,14+,15-/m1/s1 |
| InChIKey | AXHRWXQRFXBANS-XGNAHEHESA-N |
| XLogP | 0.69 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|