C24H32O6 — CID 146682420
(2S,4aR,4bS,6R,6aS,10aS,10bS,12aS)-6-hydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-6,6a,9,10,10b,11-hexahydro-4aH-naphtho[1,2-h]isochromene-1,4,5,8-tetrone (PubChem CID 146682420) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is (2S,4aR,4bS,6R,6aS,10aS,10bS,12aS)-6-hydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-6,6a,9,10,10b,11-hexahydro-4aH-naphtho[1,2-h]isochromene-1,4,5,8-tetrone.
| Compound Name | (2S,4aR,4bS,6R,6aS,10aS,10bS,12aS)-6-hydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-6,6a,9,10,10b,11-hexahydro-4aH-naphtho[1,2-h]isochromene-1,4,5,8-tetrone |
|---|---|
| PubChem CID | 146682420 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (2S,4aR,4bS,6R,6aS,10aS,10bS,12aS)-6-hydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-6,6a,9,10,10b,11-hexahydro-4aH-naphtho[1,2-h]isochromene-1,4,5,8-tetrone |
| SMILES | C=C1C[C@H]2[C@]3(C)CCC(=O)C(C)(C)[C@H]3[C@@H](O)C(=O)[C@]2(C)[C@H]2C(=O)O[C@@H](C)C(=O)[C@]12C |
| InChI | InChI=1S/C24H32O6/c1-11-10-13-22(5)9-8-14(25)21(3,4)16(22)15(26)19(28)24(13,7)17-20(29)30-12(2)18(27)23(11,17)6/h12-13,15-17,26H,1,8-10H2,2-7H3/t12-,13-,15+,16+,17-,22-,23+,24-/m0/s1 |
| InChIKey | BRAVONLOWRWBLZ-MOQICLLJSA-N |
| XLogP | 2.66 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|