C20H28O7 — CID 146682462
[(2R,3R,4S,5E,9S)-4-acetyloxy-3-hydroxy-10-oxo-2-propyl-2,3,4,7,8,9-hexahydrooxecin-9-yl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 146682462) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is [(2R,3R,4S,5E,9S)-4-acetyloxy-3-hydroxy-10-oxo-2-propyl-2,3,4,7,8,9-hexahydrooxecin-9-yl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [(2R,3R,4S,5E,9S)-4-acetyloxy-3-hydroxy-10-oxo-2-propyl-2,3,4,7,8,9-hexahydrooxecin-9-yl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 146682462 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [(2R,3R,4S,5E,9S)-4-acetyloxy-3-hydroxy-10-oxo-2-propyl-2,3,4,7,8,9-hexahydrooxecin-9-yl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)O[C@H]1CC/C=C/[C@H](OC(C)=O)[C@H](O)[C@@H](CCC)OC1=O |
| InChI | InChI=1S/C20H28O7/c1-4-6-7-13-18(22)26-17-12-9-8-11-16(25-14(3)21)19(23)15(10-5-2)27-20(17)24/h4,6-8,11,13,15-17,19,23H,5,9-10,12H2,1-3H3/b6-4+,11-8+,13-7+/t15-,16+,17+,19-/m1/s1 |
| InChIKey | WLZRYJJQSQDHOT-QCBHEWSLSA-N |
| XLogP | 2.38 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|