About (3R)-3,5-dimethyl-2-nonyl-2,3-dihydropyran-6-one
(3R)-3,5-dimethyl-2-nonyl-2,3-dihydropyran-6-one (PubChem CID 146682469) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is (3R)-3,5-dimethyl-2-nonyl-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | (3R)-3,5-dimethyl-2-nonyl-2,3-dihydropyran-6-one |
| PubChem CID | 146682469 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (3R)-3,5-dimethyl-2-nonyl-2,3-dihydropyran-6-one |
| SMILES | CCCCCCCCCC1OC(=O)C(C)=C[C@H]1C |
| InChI | InChI=1S/C16H28O2/c1-4-5-6-7-8-9-10-11-15-13(2)12-14(3)16(17)18-15/h12-13,15H,4-11H2,1-3H3/t13-,15?/m1/s1 |
| InChIKey | JRDSPDXIQMHBIV-AFYYWNPRSA-N |
| XLogP | 4.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3,5-dimethyl-2-nonyl-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3,5-dimethyl-2-nonyl-2,3-dihydropyran-6-one?
The IUPAC name of (3R)-3,5-dimethyl-2-nonyl-2,3-dihydropyran-6-one (CID 146682469) is (3R)-3,5-dimethyl-2-nonyl-2,3-dihydropyran-6-one.
What is the SMILES notation for (3R)-3,5-dimethyl-2-nonyl-2,3-dihydropyran-6-one?
The canonical SMILES for (3R)-3,5-dimethyl-2-nonyl-2,3-dihydropyran-6-one is CCCCCCCCCC1OC(=O)C(C)=C[C@H]1C.
What is the InChIKey of (3R)-3,5-dimethyl-2-nonyl-2,3-dihydropyran-6-one?
The InChIKey is JRDSPDXIQMHBIV-AFYYWNPRSA-N. The full InChI is InChI=1S/C16H28O2/c1-4-5-6-7-8-9-10-11-15-13(2)12-14(3)16(17)18-15/h12-13,15H,4-11H2,1-3H3/t13-,15?/m1/s1.
What are the key properties of (3R)-3,5-dimethyl-2-nonyl-2,3-dihydropyran-6-one?
(3R)-3,5-dimethyl-2-nonyl-2,3-dihydropyran-6-one has a molecular weight of 252.40 g/mol, XLogP of 4.63, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3,5-dimethyl-2-nonyl-2,3-dihydropyran-6-one is sourced from PubChem (CID 146682469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).