C15H26O4 — CID 146682480
(5R)-5-[(1S)-1,8-dihydroxy-2,4,6-trimethyloct-6-enyl]oxolan-2-one (PubChem CID 146682480) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (5R)-5-[(1S)-1,8-dihydroxy-2,4,6-trimethyloct-6-enyl]oxolan-2-one.
| Compound Name | (5R)-5-[(1S)-1,8-dihydroxy-2,4,6-trimethyloct-6-enyl]oxolan-2-one |
|---|---|
| PubChem CID | 146682480 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (5R)-5-[(1S)-1,8-dihydroxy-2,4,6-trimethyloct-6-enyl]oxolan-2-one |
| SMILES | CC(=CCO)CC(C)CC(C)[C@H](O)[C@H]1CCC(=O)O1 |
| InChI | InChI=1S/C15H26O4/c1-10(6-7-16)8-11(2)9-12(3)15(18)13-4-5-14(17)19-13/h6,11-13,15-16,18H,4-5,7-9H2,1-3H3/t11?,12?,13-,15+/m1/s1 |
| InChIKey | CIWHGWDVOWJXJH-SJQFEJMWSA-N |
| XLogP | 2.04 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|