C15H24O4 — CID 146682518
(1R,4R,7S,8R,11R,12R)-7,11-dihydroxy-3,3,7,11-tetramethyl-2-oxatricyclo[6.3.1.04,12]dodecan-10-one (PubChem CID 146682518) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (1R,4R,7S,8R,11R,12R)-7,11-dihydroxy-3,3,7,11-tetramethyl-2-oxatricyclo[6.3.1.04,12]dodecan-10-one.
| Compound Name | (1R,4R,7S,8R,11R,12R)-7,11-dihydroxy-3,3,7,11-tetramethyl-2-oxatricyclo[6.3.1.04,12]dodecan-10-one |
|---|---|
| PubChem CID | 146682518 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (1R,4R,7S,8R,11R,12R)-7,11-dihydroxy-3,3,7,11-tetramethyl-2-oxatricyclo[6.3.1.04,12]dodecan-10-one |
| SMILES | CC1(C)O[C@@H]2[C@H]3[C@H]1CC[C@](C)(O)[C@@H]3CC(=O)[C@]2(C)O |
| InChI | InChI=1S/C15H24O4/c1-13(2)8-5-6-14(3,17)9-7-10(16)15(4,18)12(19-13)11(8)9/h8-9,11-12,17-18H,5-7H2,1-4H3/t8-,9-,11+,12-,14+,15+/m1/s1 |
| InChIKey | FQJNBMDLOIHXER-PFJQPICRSA-N |
| XLogP | 1.28 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |