C14H18O3 — CID 146682554
(5S,6S)-5-methyl-6-[(2E,4E,6E)-octa-2,4,6-trien-2-yl]oxane-2,4-dione (PubChem CID 146682554) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is (5S,6S)-5-methyl-6-[(2E,4E,6E)-octa-2,4,6-trien-2-yl]oxane-2,4-dione.
| Compound Name | (5S,6S)-5-methyl-6-[(2E,4E,6E)-octa-2,4,6-trien-2-yl]oxane-2,4-dione |
|---|---|
| PubChem CID | 146682554 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (5S,6S)-5-methyl-6-[(2E,4E,6E)-octa-2,4,6-trien-2-yl]oxane-2,4-dione |
| SMILES | C/C=C/C=C/C=C(\C)[C@H]1OC(=O)CC(=O)[C@H]1C |
| InChI | InChI=1S/C14H18O3/c1-4-5-6-7-8-10(2)14-11(3)12(15)9-13(16)17-14/h4-8,11,14H,9H2,1-3H3/b5-4+,7-6+,10-8+/t11-,14-/m1/s1 |
| InChIKey | DXBJPNHJQDZLKI-DVJPBPTDSA-N |
| XLogP | 2.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|