C20H26O3 — CID 146682558
(3S,4aS)-3-[(3R)-3-ethenyl-3-methyl-6-oxocyclohexen-1-yl]-5,5-dimethyl-1,4a,6,7-tetrahydroisochromen-4-one (PubChem CID 146682558) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (3S,4aS)-3-[(3R)-3-ethenyl-3-methyl-6-oxocyclohexen-1-yl]-5,5-dimethyl-1,4a,6,7-tetrahydroisochromen-4-one.
| Compound Name | (3S,4aS)-3-[(3R)-3-ethenyl-3-methyl-6-oxocyclohexen-1-yl]-5,5-dimethyl-1,4a,6,7-tetrahydroisochromen-4-one |
|---|---|
| PubChem CID | 146682558 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (3S,4aS)-3-[(3R)-3-ethenyl-3-methyl-6-oxocyclohexen-1-yl]-5,5-dimethyl-1,4a,6,7-tetrahydroisochromen-4-one |
| SMILES | C=C[C@]1(C)C=C([C@@H]2OCC3=CCCC(C)(C)[C@@H]3C2=O)C(=O)CC1 |
| InChI | InChI=1S/C20H26O3/c1-5-20(4)10-8-15(21)14(11-20)18-17(22)16-13(12-23-18)7-6-9-19(16,2)3/h5,7,11,16,18H,1,6,8-10,12H2,2-4H3/t16-,18-,20-/m0/s1 |
| InChIKey | OBEMDIWOJBJBGY-QRFRQXIXSA-N |
| XLogP | 3.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|