About 4-hydroxy-6-[(E,2S)-2-hydroxyhept-5-enyl]-3-methylpyran-2-one
4-hydroxy-6-[(E,2S)-2-hydroxyhept-5-enyl]-3-methylpyran-2-one (PubChem CID 146682578) has the molecular formula C13H18O4
and a molecular weight of 238.28 g/mol. Its IUPAC name is 4-hydroxy-6-[(E,2S)-2-hydroxyhept-5-enyl]-3-methylpyran-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-6-[(E,2S)-2-hydroxyhept-5-enyl]-3-methylpyran-2-one |
| PubChem CID | 146682578 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 4-hydroxy-6-[(E,2S)-2-hydroxyhept-5-enyl]-3-methylpyran-2-one |
| SMILES | C/C=C/CC[C@H](O)Cc1cc(O)c(C)c(=O)o1 |
| InChI | InChI=1S/C13H18O4/c1-3-4-5-6-10(14)7-11-8-12(15)9(2)13(16)17-11/h3-4,8,10,14-15H,5-7H2,1-2H3/b4-3+/t10-/m0/s1 |
| InChIKey | RYNJIMOMAPRLSD-FSIBCCDJSA-N |
| XLogP | 1.91 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-6-[(E,2S)-2-hydroxyhept-5-enyl]-3-methylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-6-[(E,2S)-2-hydroxyhept-5-enyl]-3-methylpyran-2-one?
The IUPAC name of 4-hydroxy-6-[(E,2S)-2-hydroxyhept-5-enyl]-3-methylpyran-2-one (CID 146682578) is 4-hydroxy-6-[(E,2S)-2-hydroxyhept-5-enyl]-3-methylpyran-2-one.
What is the SMILES notation for 4-hydroxy-6-[(E,2S)-2-hydroxyhept-5-enyl]-3-methylpyran-2-one?
The canonical SMILES for 4-hydroxy-6-[(E,2S)-2-hydroxyhept-5-enyl]-3-methylpyran-2-one is C/C=C/CC[C@H](O)Cc1cc(O)c(C)c(=O)o1.
What is the InChIKey of 4-hydroxy-6-[(E,2S)-2-hydroxyhept-5-enyl]-3-methylpyran-2-one?
The InChIKey is RYNJIMOMAPRLSD-FSIBCCDJSA-N. The full InChI is InChI=1S/C13H18O4/c1-3-4-5-6-10(14)7-11-8-12(15)9(2)13(16)17-11/h3-4,8,10,14-15H,5-7H2,1-2H3/b4-3+/t10-/m0/s1.
What are the key properties of 4-hydroxy-6-[(E,2S)-2-hydroxyhept-5-enyl]-3-methylpyran-2-one?
4-hydroxy-6-[(E,2S)-2-hydroxyhept-5-enyl]-3-methylpyran-2-one has a molecular weight of 238.28 g/mol, XLogP of 1.91, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-6-[(E,2S)-2-hydroxyhept-5-enyl]-3-methylpyran-2-one is sourced from PubChem (CID 146682578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).