C14H20O8 — CID 146682584
methyl (2R,4R,6S)-4-hydroxy-2,4-dimethyl-6-(2-methylbutanoyloxy)-3,5-dioxooxane-2-carboxylate (PubChem CID 146682584) has the molecular formula C14H20O8 and a molecular weight of 316.31 g/mol. Its IUPAC name is methyl (2R,4R,6S)-4-hydroxy-2,4-dimethyl-6-(2-methylbutanoyloxy)-3,5-dioxooxane-2-carboxylate.
| Compound Name | methyl (2R,4R,6S)-4-hydroxy-2,4-dimethyl-6-(2-methylbutanoyloxy)-3,5-dioxooxane-2-carboxylate |
|---|---|
| PubChem CID | 146682584 |
| Molecular Formula | C14H20O8 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | methyl (2R,4R,6S)-4-hydroxy-2,4-dimethyl-6-(2-methylbutanoyloxy)-3,5-dioxooxane-2-carboxylate |
| SMILES | CCC(C)C(=O)O[C@@H]1O[C@@](C)(C(=O)OC)C(=O)[C@@](C)(O)C1=O |
| InChI | InChI=1S/C14H20O8/c1-6-7(2)9(16)21-10-8(15)13(3,19)11(17)14(4,22-10)12(18)20-5/h7,10,19H,6H2,1-5H3/t7?,10-,13+,14-/m1/s1 |
| InChIKey | ZMKSDIASUBQUJL-HSCQSRIDSA-N |
| XLogP | -0.25 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|