C20H36O7 — CID 146682593
(2S,3R,4R,5R)-2-[(2E,6E)-10,11-dihydroxy-3,7,11-trimethyldodeca-2,6-dienoxy]oxane-3,4,5-triol (PubChem CID 146682593) has the molecular formula C20H36O7 and a molecular weight of 388.50 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-[(2E,6E)-10,11-dihydroxy-3,7,11-trimethyldodeca-2,6-dienoxy]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R)-2-[(2E,6E)-10,11-dihydroxy-3,7,11-trimethyldodeca-2,6-dienoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 146682593 |
| Molecular Formula | C20H36O7 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (2S,3R,4R,5R)-2-[(2E,6E)-10,11-dihydroxy-3,7,11-trimethyldodeca-2,6-dienoxy]oxane-3,4,5-triol |
| SMILES | C/C(=C\CO[C@H]1OC[C@@H](O)[C@@H](O)[C@H]1O)CC/C=C(\C)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C20H36O7/c1-13(8-9-16(22)20(3,4)25)6-5-7-14(2)10-11-26-19-18(24)17(23)15(21)12-27-19/h6,10,15-19,21-25H,5,7-9,11-12H2,1-4H3/b13-6+,14-10+/t15-,16?,17-,18-,19+/m1/s1 |
| InChIKey | QACWMNZFODZSPG-UHRNMSSKSA-N |
| XLogP | 1.03 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|