C29H32O13 — CID 146682611
4,4a,11,12a-tetrahydroxy-3-methoxy-10-methyl-8-[(2S,3S,4S,5R,6R)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxy-4H-tetracene-1,5,12-trione (PubChem CID 146682611) has the molecular formula C29H32O13 and a molecular weight of 588.56 g/mol. Its IUPAC name is 4,4a,11,12a-tetrahydroxy-3-methoxy-10-methyl-8-[(2S,3S,4S,5R,6R)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxy-4H-tetracene-1,5,12-trione.
| Compound Name | 4,4a,11,12a-tetrahydroxy-3-methoxy-10-methyl-8-[(2S,3S,4S,5R,6R)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxy-4H-tetracene-1,5,12-trione |
|---|---|
| PubChem CID | 146682611 |
| Molecular Formula | C29H32O13 |
| Molecular Weight | 588.56 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | 4,4a,11,12a-tetrahydroxy-3-methoxy-10-methyl-8-[(2S,3S,4S,5R,6R)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxy-4H-tetracene-1,5,12-trione |
| SMILES | COC1=CC(=O)C2(O)C(=O)c3c(cc4cc(O[C@@H]5O[C@H](C)[C@@H](OC)[C@H](OC)[C@@H]5OC)cc(C)c4c3O)C(=O)C2(O)C1O |
| InChI | InChI=1S/C29H32O13/c1-11-7-14(42-27-23(40-6)22(39-5)21(38-4)12(2)41-27)8-13-9-15-19(20(31)18(11)13)26(34)28(35)17(30)10-16(37-3)25(33)29(28,36)24(15)32/h7-10,12,21-23,25,27,31,33,35-36H,1-6H3/t12-,21-,22+,23+,25?,27+,28?,29?/m1/s1 |
| InChIKey | YJAVYCWOHQXQFR-BDEZBQFBSA-N |
| XLogP | 0.34 |
| TPSA | 187.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.56 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|