C15H18O5 — CID 146682648
(1S,2R,3R,5R,6S,9R)-2,3-dihydroxy-3-methyl-9-[(1E,3E)-penta-1,3-dienyl]-4,11-dioxatricyclo[4.3.2.01,5]undec-7-en-10-one (PubChem CID 146682648) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (1S,2R,3R,5R,6S,9R)-2,3-dihydroxy-3-methyl-9-[(1E,3E)-penta-1,3-dienyl]-4,11-dioxatricyclo[4.3.2.01,5]undec-7-en-10-one.
| Compound Name | (1S,2R,3R,5R,6S,9R)-2,3-dihydroxy-3-methyl-9-[(1E,3E)-penta-1,3-dienyl]-4,11-dioxatricyclo[4.3.2.01,5]undec-7-en-10-one |
|---|---|
| PubChem CID | 146682648 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (1S,2R,3R,5R,6S,9R)-2,3-dihydroxy-3-methyl-9-[(1E,3E)-penta-1,3-dienyl]-4,11-dioxatricyclo[4.3.2.01,5]undec-7-en-10-one |
| SMILES | C/C=C/C=C/[C@@H]1C=C[C@@H]2OC(=O)[C@]13[C@@H](O)[C@](C)(O)O[C@@H]23 |
| InChI | InChI=1S/C15H18O5/c1-3-4-5-6-9-7-8-10-11-15(9,13(17)19-10)12(16)14(2,18)20-11/h3-12,16,18H,1-2H3/b4-3+,6-5+/t9-,10+,11+,12+,14-,15-/m1/s1 |
| InChIKey | YLMAGAQAYKUZNT-SNOOIOOMSA-N |
| XLogP | 0.68 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|