C15H18O5 — CID 146682651
3-[(2S,3Z,5R,6E,8E)-1,2-dihydroxydeca-3,6,8-trien-5-yl]-4-hydroxy-5-methylidenefuran-2-one (PubChem CID 146682651) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is 3-[(2S,3Z,5R,6E,8E)-1,2-dihydroxydeca-3,6,8-trien-5-yl]-4-hydroxy-5-methylidenefuran-2-one.
| Compound Name | 3-[(2S,3Z,5R,6E,8E)-1,2-dihydroxydeca-3,6,8-trien-5-yl]-4-hydroxy-5-methylidenefuran-2-one |
|---|---|
| PubChem CID | 146682651 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3-[(2S,3Z,5R,6E,8E)-1,2-dihydroxydeca-3,6,8-trien-5-yl]-4-hydroxy-5-methylidenefuran-2-one |
| SMILES | C=C1OC(=O)C([C@@H](/C=C\[C@H](O)CO)/C=C/C=C/C)=C1O |
| InChI | InChI=1S/C15H18O5/c1-3-4-5-6-11(7-8-12(17)9-16)13-14(18)10(2)20-15(13)19/h3-8,11-12,16-18H,2,9H2,1H3/b4-3+,6-5+,8-7-/t11-,12+/m1/s1 |
| InChIKey | QULCESNEBMHBMM-ZIEXSGFDSA-N |
| XLogP | 1.53 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|