About 6,7-dioxopyrrolo[1,2-b]isoquinoline-3-carboxylic acid
6,7-dioxopyrrolo[1,2-b]isoquinoline-3-carboxylic acid (PubChem CID 146682674) has the molecular formula C13H7NO4
and a molecular weight of 241.20 g/mol. Its IUPAC name is 6,7-dioxopyrrolo[1,2-b]isoquinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 6,7-dioxopyrrolo[1,2-b]isoquinoline-3-carboxylic acid |
| PubChem CID | 146682674 |
| Molecular Formula | C13H7NO4 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 6,7-dioxopyrrolo[1,2-b]isoquinoline-3-carboxylic acid |
| SMILES | O=C1C=Cc2cc3ccc(C(=O)O)n3cc2C1=O |
| InChI | InChI=1S/C13H7NO4/c15-11-4-1-7-5-8-2-3-10(13(17)18)14(8)6-9(7)12(11)16/h1-6H,(H,17,18) |
| InChIKey | QEGMHBAVHYBAMB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 75.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dioxopyrrolo[1,2-b]isoquinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dioxopyrrolo[1,2-b]isoquinoline-3-carboxylic acid?
The IUPAC name of 6,7-dioxopyrrolo[1,2-b]isoquinoline-3-carboxylic acid (CID 146682674) is 6,7-dioxopyrrolo[1,2-b]isoquinoline-3-carboxylic acid.
What is the SMILES notation for 6,7-dioxopyrrolo[1,2-b]isoquinoline-3-carboxylic acid?
The canonical SMILES for 6,7-dioxopyrrolo[1,2-b]isoquinoline-3-carboxylic acid is O=C1C=Cc2cc3ccc(C(=O)O)n3cc2C1=O.
What is the InChIKey of 6,7-dioxopyrrolo[1,2-b]isoquinoline-3-carboxylic acid?
The InChIKey is QEGMHBAVHYBAMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7NO4/c15-11-4-1-7-5-8-2-3-10(13(17)18)14(8)6-9(7)12(11)16/h1-6H,(H,17,18).
What are the key properties of 6,7-dioxopyrrolo[1,2-b]isoquinoline-3-carboxylic acid?
6,7-dioxopyrrolo[1,2-b]isoquinoline-3-carboxylic acid has a molecular weight of 241.20 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dioxopyrrolo[1,2-b]isoquinoline-3-carboxylic acid is sourced from PubChem (CID 146682674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).