About methyl 2-[8-(2-methoxy-2-oxoethyl)-2,10-dioxo-1,6-dioxecan-3-yl]acetate
methyl 2-[8-(2-methoxy-2-oxoethyl)-2,10-dioxo-1,6-dioxecan-3-yl]acetate (PubChem CID 146682709) has the molecular formula C14H20O8
and a molecular weight of 316.31 g/mol. Its IUPAC name is methyl 2-[8-(2-methoxy-2-oxoethyl)-2,10-dioxo-1,6-dioxecan-3-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[8-(2-methoxy-2-oxoethyl)-2,10-dioxo-1,6-dioxecan-3-yl]acetate |
| PubChem CID | 146682709 |
| Molecular Formula | C14H20O8 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | methyl 2-[8-(2-methoxy-2-oxoethyl)-2,10-dioxo-1,6-dioxecan-3-yl]acetate |
| SMILES | COC(=O)CC1COCCC(CC(=O)OC)C(=O)OC(=O)C1 |
| InChI | InChI=1S/C14H20O8/c1-19-11(15)5-9-6-13(17)22-14(18)10(3-4-21-8-9)7-12(16)20-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | MCPQSWSJBAOZSJ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[8-(2-methoxy-2-oxoethyl)-2,10-dioxo-1,6-dioxecan-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[8-(2-methoxy-2-oxoethyl)-2,10-dioxo-1,6-dioxecan-3-yl]acetate?
The IUPAC name of methyl 2-[8-(2-methoxy-2-oxoethyl)-2,10-dioxo-1,6-dioxecan-3-yl]acetate (CID 146682709) is methyl 2-[8-(2-methoxy-2-oxoethyl)-2,10-dioxo-1,6-dioxecan-3-yl]acetate.
What is the SMILES notation for methyl 2-[8-(2-methoxy-2-oxoethyl)-2,10-dioxo-1,6-dioxecan-3-yl]acetate?
The canonical SMILES for methyl 2-[8-(2-methoxy-2-oxoethyl)-2,10-dioxo-1,6-dioxecan-3-yl]acetate is COC(=O)CC1COCCC(CC(=O)OC)C(=O)OC(=O)C1.
What is the InChIKey of methyl 2-[8-(2-methoxy-2-oxoethyl)-2,10-dioxo-1,6-dioxecan-3-yl]acetate?
The InChIKey is MCPQSWSJBAOZSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O8/c1-19-11(15)5-9-6-13(17)22-14(18)10(3-4-21-8-9)7-12(16)20-2/h9-10H,3-8H2,1-2H3.
What are the key properties of methyl 2-[8-(2-methoxy-2-oxoethyl)-2,10-dioxo-1,6-dioxecan-3-yl]acetate?
methyl 2-[8-(2-methoxy-2-oxoethyl)-2,10-dioxo-1,6-dioxecan-3-yl]acetate has a molecular weight of 316.31 g/mol, XLogP of 0.23, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[8-(2-methoxy-2-oxoethyl)-2,10-dioxo-1,6-dioxecan-3-yl]acetate is sourced from PubChem (CID 146682709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).