C27H40O9 — CID 146682713
methyl (2S)-2-[[(3S,3aS,6R,6aR)-6-hexyl-2,4-dioxo-3,3a,6,6a-tetrahydrofuro[2,3-c]furan-3-yl]methyl]-2-[(1R)-1-hydroxyheptyl]-4-methyl-5-oxofuran-3-carboxylate (PubChem CID 146682713) has the molecular formula C27H40O9 and a molecular weight of 508.61 g/mol. Its IUPAC name is methyl (2S)-2-[[(3S,3aS,6R,6aR)-6-hexyl-2,4-dioxo-3,3a,6,6a-tetrahydrofuro[2,3-c]furan-3-yl]methyl]-2-[(1R)-1-hydroxyheptyl]-4-methyl-5-oxofuran-3-carboxylate.
| Compound Name | methyl (2S)-2-[[(3S,3aS,6R,6aR)-6-hexyl-2,4-dioxo-3,3a,6,6a-tetrahydrofuro[2,3-c]furan-3-yl]methyl]-2-[(1R)-1-hydroxyheptyl]-4-methyl-5-oxofuran-3-carboxylate |
|---|---|
| PubChem CID | 146682713 |
| Molecular Formula | C27H40O9 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | methyl (2S)-2-[[(3S,3aS,6R,6aR)-6-hexyl-2,4-dioxo-3,3a,6,6a-tetrahydrofuro[2,3-c]furan-3-yl]methyl]-2-[(1R)-1-hydroxyheptyl]-4-methyl-5-oxofuran-3-carboxylate |
| SMILES | CCCCCC[C@@H](O)[C@@]1(C[C@@H]2C(=O)O[C@@H]3[C@H]2C(=O)O[C@@H]3CCCCCC)OC(=O)C(C)=C1C(=O)OC |
| InChI | InChI=1S/C27H40O9/c1-5-7-9-11-13-18-22-20(25(31)34-18)17(24(30)35-22)15-27(19(28)14-12-10-8-6-2)21(26(32)33-4)16(3)23(29)36-27/h17-20,22,28H,5-15H2,1-4H3/t17-,18+,19+,20-,22-,27+/m0/s1 |
| InChIKey | CPYDOXWTPKFFRN-KYZFODTRSA-N |
| XLogP | 3.55 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|