C18H26O5 — CID 146682714
(2E,4E,8E)-11-[(2R,3R)-3-(hydroxymethyl)-4-oxooxetan-2-yl]-3,5,7-trimethylundeca-2,4,8-trienoic acid (PubChem CID 146682714) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is (2E,4E,8E)-11-[(2R,3R)-3-(hydroxymethyl)-4-oxooxetan-2-yl]-3,5,7-trimethylundeca-2,4,8-trienoic acid.
| Compound Name | (2E,4E,8E)-11-[(2R,3R)-3-(hydroxymethyl)-4-oxooxetan-2-yl]-3,5,7-trimethylundeca-2,4,8-trienoic acid |
|---|---|
| PubChem CID | 146682714 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (2E,4E,8E)-11-[(2R,3R)-3-(hydroxymethyl)-4-oxooxetan-2-yl]-3,5,7-trimethylundeca-2,4,8-trienoic acid |
| SMILES | CC(=C\C(=O)O)/C=C(\C)CC(C)/C=C/CC[C@H]1OC(=O)[C@@H]1CO |
| InChI | InChI=1S/C18H26O5/c1-12(8-13(2)9-14(3)10-17(20)21)6-4-5-7-16-15(11-19)18(22)23-16/h4,6,9-10,12,15-16,19H,5,7-8,11H2,1-3H3,(H,20,21)/b6-4+,13-9+,14-10+/t12?,15-,16-/m1/s1 |
| InChIKey | QUCDEPYCVWHNEJ-FDFUWUKBSA-N |
| XLogP | 2.86 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|