C20H32O5 — CID 146682715
(2E,4E)-11-[(2S,4R,5S)-4-hydroxy-5-methyl-6-oxooxan-2-yl]-3,5,7-trimethylundeca-2,4-dienoic acid (PubChem CID 146682715) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (2E,4E)-11-[(2S,4R,5S)-4-hydroxy-5-methyl-6-oxooxan-2-yl]-3,5,7-trimethylundeca-2,4-dienoic acid.
| Compound Name | (2E,4E)-11-[(2S,4R,5S)-4-hydroxy-5-methyl-6-oxooxan-2-yl]-3,5,7-trimethylundeca-2,4-dienoic acid |
|---|---|
| PubChem CID | 146682715 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (2E,4E)-11-[(2S,4R,5S)-4-hydroxy-5-methyl-6-oxooxan-2-yl]-3,5,7-trimethylundeca-2,4-dienoic acid |
| SMILES | CC(=C\C(=O)O)/C=C(\C)CC(C)CCCC[C@H]1C[C@@H](O)[C@H](C)C(=O)O1 |
| InChI | InChI=1S/C20H32O5/c1-13(9-14(2)10-15(3)11-19(22)23)7-5-6-8-17-12-18(21)16(4)20(24)25-17/h10-11,13,16-18,21H,5-9,12H2,1-4H3,(H,22,23)/b14-10+,15-11+/t13?,16-,17-,18+/m0/s1 |
| InChIKey | UJFSPDOPSFJXRP-KMJWBMAQSA-N |
| XLogP | 3.86 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|