About 3-chloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2,5,6-trimethoxybenzamide
3-chloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2,5,6-trimethoxybenzamide (PubChem CID 14668272) has the molecular formula C17H25ClN2O4
and a molecular weight of 356.85 g/mol. Its IUPAC name is 3-chloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2,5,6-trimethoxybenzamide.
Molecular Properties
| Compound Name | 3-chloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2,5,6-trimethoxybenzamide |
| PubChem CID | 14668272 |
| Molecular Formula | C17H25ClN2O4 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 3-chloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2,5,6-trimethoxybenzamide |
| SMILES | CCN1CCC[C@H]1CNC(=O)c1c(OC)c(Cl)cc(OC)c1OC |
| InChI | InChI=1S/C17H25ClN2O4/c1-5-20-8-6-7-11(20)10-19-17(21)14-15(23-3)12(18)9-13(22-2)16(14)24-4/h9,11H,5-8,10H2,1-4H3,(H,19,21)/t11-/m0/s1 |
| InChIKey | MPKKCEUANNGJTC-NSHDSACASA-N |
| XLogP | 2.58 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2,5,6-trimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2,5,6-trimethoxybenzamide?
The IUPAC name of 3-chloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2,5,6-trimethoxybenzamide (CID 14668272) is 3-chloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2,5,6-trimethoxybenzamide.
What is the SMILES notation for 3-chloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2,5,6-trimethoxybenzamide?
The canonical SMILES for 3-chloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2,5,6-trimethoxybenzamide is CCN1CCC[C@H]1CNC(=O)c1c(OC)c(Cl)cc(OC)c1OC.
What is the InChIKey of 3-chloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2,5,6-trimethoxybenzamide?
The InChIKey is MPKKCEUANNGJTC-NSHDSACASA-N. The full InChI is InChI=1S/C17H25ClN2O4/c1-5-20-8-6-7-11(20)10-19-17(21)14-15(23-3)12(18)9-13(22-2)16(14)24-4/h9,11H,5-8,10H2,1-4H3,(H,19,21)/t11-/m0/s1.
What are the key properties of 3-chloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2,5,6-trimethoxybenzamide?
3-chloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2,5,6-trimethoxybenzamide has a molecular weight of 356.85 g/mol, XLogP of 2.58, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2,5,6-trimethoxybenzamide is sourced from PubChem (CID 14668272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).