C16H26O3 — CID 146682790
1-[(1R,4R,4aS,6S,8aS)-4-hydroxy-1,2,6-trimethyl-4a,5,6,7,8,8a-hexahydro-4H-naphthalen-1-yl]-3-hydroxypropan-1-one (PubChem CID 146682790) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 1-[(1R,4R,4aS,6S,8aS)-4-hydroxy-1,2,6-trimethyl-4a,5,6,7,8,8a-hexahydro-4H-naphthalen-1-yl]-3-hydroxypropan-1-one.
| Compound Name | 1-[(1R,4R,4aS,6S,8aS)-4-hydroxy-1,2,6-trimethyl-4a,5,6,7,8,8a-hexahydro-4H-naphthalen-1-yl]-3-hydroxypropan-1-one |
|---|---|
| PubChem CID | 146682790 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 1-[(1R,4R,4aS,6S,8aS)-4-hydroxy-1,2,6-trimethyl-4a,5,6,7,8,8a-hexahydro-4H-naphthalen-1-yl]-3-hydroxypropan-1-one |
| SMILES | CC1=C[C@H](O)[C@H]2C[C@@H](C)CC[C@@H]2[C@@]1(C)C(=O)CCO |
| InChI | InChI=1S/C16H26O3/c1-10-4-5-13-12(8-10)14(18)9-11(2)16(13,3)15(19)6-7-17/h9-10,12-14,17-18H,4-8H2,1-3H3/t10-,12-,13-,14-,16-/m0/s1 |
| InChIKey | QOTPZDXCMPNKJZ-XZHFZGJDSA-N |
| XLogP | 2.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|