C34H62O8 — CID 146682805
[(6E,10R,11S,14S,15R,18E)-14-acetyloxy-2,10,15,23-tetrahydroxy-2,6,10,15,19,23-hexamethyltetracosa-6,18-dien-11-yl] acetate (PubChem CID 146682805) has the molecular formula C34H62O8 and a molecular weight of 598.86 g/mol. Its IUPAC name is [(6E,10R,11S,14S,15R,18E)-14-acetyloxy-2,10,15,23-tetrahydroxy-2,6,10,15,19,23-hexamethyltetracosa-6,18-dien-11-yl] acetate.
| Compound Name | [(6E,10R,11S,14S,15R,18E)-14-acetyloxy-2,10,15,23-tetrahydroxy-2,6,10,15,19,23-hexamethyltetracosa-6,18-dien-11-yl] acetate |
|---|---|
| PubChem CID | 146682805 |
| Molecular Formula | C34H62O8 |
| Molecular Weight | 598.86 g/mol |
| Exact Mass | 598.44 |
| IUPAC Name | [(6E,10R,11S,14S,15R,18E)-14-acetyloxy-2,10,15,23-tetrahydroxy-2,6,10,15,19,23-hexamethyltetracosa-6,18-dien-11-yl] acetate |
| SMILES | CC(=O)O[C@@H](CC[C@H](OC(C)=O)[C@](C)(O)CC/C=C(\C)CCCC(C)(C)O)[C@](C)(O)CC/C=C(\C)CCCC(C)(C)O |
| InChI | InChI=1S/C34H62O8/c1-25(15-11-21-31(5,6)37)17-13-23-33(9,39)29(41-27(3)35)19-20-30(42-28(4)36)34(10,40)24-14-18-26(2)16-12-22-32(7,8)38/h17-18,29-30,37-40H,11-16,19-24H2,1-10H3/b25-17+,26-18+/t29-,30-,33+,34+/m0/s1 |
| InChIKey | CAZUZUXTXAVONW-SZKNPUAUSA-N |
| XLogP | 6.47 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.86 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|