C30H58O6 — CID 146682809
(6E,10R,11S,14S,15R,18E)-2,6,10,15,19,23-hexamethyltetracosa-6,18-diene-2,10,11,14,15,23-hexol (PubChem CID 146682809) has the molecular formula C30H58O6 and a molecular weight of 514.79 g/mol. Its IUPAC name is (6E,10R,11S,14S,15R,18E)-2,6,10,15,19,23-hexamethyltetracosa-6,18-diene-2,10,11,14,15,23-hexol.
| Compound Name | (6E,10R,11S,14S,15R,18E)-2,6,10,15,19,23-hexamethyltetracosa-6,18-diene-2,10,11,14,15,23-hexol |
|---|---|
| PubChem CID | 146682809 |
| Molecular Formula | C30H58O6 |
| Molecular Weight | 514.79 g/mol |
| Exact Mass | 514.42 |
| IUPAC Name | (6E,10R,11S,14S,15R,18E)-2,6,10,15,19,23-hexamethyltetracosa-6,18-diene-2,10,11,14,15,23-hexol |
| SMILES | C/C(=C\CC[C@@](C)(O)[C@@H](O)CC[C@H](O)[C@](C)(O)CC/C=C(\C)CCCC(C)(C)O)CCCC(C)(C)O |
| InChI | InChI=1S/C30H58O6/c1-23(13-9-19-27(3,4)33)15-11-21-29(7,35)25(31)17-18-26(32)30(8,36)22-12-16-24(2)14-10-20-28(5,6)34/h15-16,25-26,31-36H,9-14,17-22H2,1-8H3/b23-15+,24-16+/t25-,26-,29+,30+/m0/s1 |
| InChIKey | LVVVRYBRIUFULZ-XHARVQFDSA-N |
| XLogP | 5.33 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.79 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|