C12H18O4 — CID 146682841
(2E,4E,6S,7S)-6-hydroxy-3,7-dimethyl-8-oxodeca-2,4-dienoic acid (PubChem CID 146682841) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (2E,4E,6S,7S)-6-hydroxy-3,7-dimethyl-8-oxodeca-2,4-dienoic acid.
| Compound Name | (2E,4E,6S,7S)-6-hydroxy-3,7-dimethyl-8-oxodeca-2,4-dienoic acid |
|---|---|
| PubChem CID | 146682841 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (2E,4E,6S,7S)-6-hydroxy-3,7-dimethyl-8-oxodeca-2,4-dienoic acid |
| SMILES | CCC(=O)[C@@H](C)[C@@H](O)/C=C/C(C)=C/C(=O)O |
| InChI | InChI=1S/C12H18O4/c1-4-10(13)9(3)11(14)6-5-8(2)7-12(15)16/h5-7,9,11,14H,4H2,1-3H3,(H,15,16)/b6-5+,8-7+/t9-,11+/m1/s1 |
| InChIKey | ZAUVCPKOTKAFRS-WADGAMFQSA-N |
| XLogP | 1.55 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|