C12H22O4 — CID 146682843
(E,4S,5S,8S,9R)-5,8,9-trihydroxy-4,8-dimethyldec-6-en-3-one (PubChem CID 146682843) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is (E,4S,5S,8S,9R)-5,8,9-trihydroxy-4,8-dimethyldec-6-en-3-one.
| Compound Name | (E,4S,5S,8S,9R)-5,8,9-trihydroxy-4,8-dimethyldec-6-en-3-one |
|---|---|
| PubChem CID | 146682843 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (E,4S,5S,8S,9R)-5,8,9-trihydroxy-4,8-dimethyldec-6-en-3-one |
| SMILES | CCC(=O)[C@@H](C)[C@@H](O)/C=C/[C@](C)(O)[C@@H](C)O |
| InChI | InChI=1S/C12H22O4/c1-5-10(14)8(2)11(15)6-7-12(4,16)9(3)13/h6-9,11,13,15-16H,5H2,1-4H3/b7-6+/t8-,9-,11+,12+/m1/s1 |
| InChIKey | ARSRADVFWDFHKN-DHHUEORBSA-N |
| XLogP | 0.65 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|