C16H28O3 — CID 146682847
(6E,8E,11S)-1,11-dihydroxy-2,2,10,10-tetramethyldodeca-6,8-dien-3-one (PubChem CID 146682847) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is (6E,8E,11S)-1,11-dihydroxy-2,2,10,10-tetramethyldodeca-6,8-dien-3-one.
| Compound Name | (6E,8E,11S)-1,11-dihydroxy-2,2,10,10-tetramethyldodeca-6,8-dien-3-one |
|---|---|
| PubChem CID | 146682847 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (6E,8E,11S)-1,11-dihydroxy-2,2,10,10-tetramethyldodeca-6,8-dien-3-one |
| SMILES | C[C@H](O)C(C)(C)/C=C/C=C/CCC(=O)C(C)(C)CO |
| InChI | InChI=1S/C16H28O3/c1-13(18)15(2,3)11-9-7-6-8-10-14(19)16(4,5)12-17/h6-7,9,11,13,17-18H,8,10,12H2,1-5H3/b7-6+,11-9+/t13-/m0/s1 |
| InChIKey | TWZVGLYLTHNTQX-PCJSDPOXSA-N |
| XLogP | 2.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|