C15H28O2 — CID 146682850
(2S,4E,6E)-3,3,11-trimethyldodeca-4,6-diene-2,10-diol (PubChem CID 146682850) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (2S,4E,6E)-3,3,11-trimethyldodeca-4,6-diene-2,10-diol.
| Compound Name | (2S,4E,6E)-3,3,11-trimethyldodeca-4,6-diene-2,10-diol |
|---|---|
| PubChem CID | 146682850 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (2S,4E,6E)-3,3,11-trimethyldodeca-4,6-diene-2,10-diol |
| SMILES | CC(C)C(O)CC/C=C/C=C/C(C)(C)[C@H](C)O |
| InChI | InChI=1S/C15H28O2/c1-12(2)14(17)10-8-6-7-9-11-15(4,5)13(3)16/h6-7,9,11-14,16-17H,8,10H2,1-5H3/b7-6+,11-9+/t13-,14?/m0/s1 |
| InChIKey | NNWCXCVXEGPTMN-DUOCIRQLSA-N |
| XLogP | 3.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|