C16H20O5 — CID 146682861
2-deca-4,6,8-triynoxy-6-methyloxane-3,4,5-triol (PubChem CID 146682861) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-deca-4,6,8-triynoxy-6-methyloxane-3,4,5-triol.
| Compound Name | 2-deca-4,6,8-triynoxy-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 146682861 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-deca-4,6,8-triynoxy-6-methyloxane-3,4,5-triol |
| SMILES | CC#CC#CC#CCCCOC1OC(C)C(O)C(O)C1O |
| InChI | InChI=1S/C16H20O5/c1-3-4-5-6-7-8-9-10-11-20-16-15(19)14(18)13(17)12(2)21-16/h12-19H,9-11H2,1-2H3 |
| InChIKey | BXGITTUFZVFDAJ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|