About Paenidigyamycin A
Paenidigyamycin A (PubChem CID 146682879) has the molecular formula C36H52N4+2
and a molecular weight of 540.80 g/mol. Its IUPAC name is 2-[4,5-dimethyl-1-(3-methylbutyl)-3-(2-phenylethyl)imidazol-1-ium-2-yl]-4,5-dimethyl-1-(3-methylbutyl)-3-(2-phenylethyl)imidazol-1-ium.
Molecular Properties
| Compound Name | Paenidigyamycin A |
| PubChem CID | 146682879 |
| Molecular Formula | C36H52N4+2 |
| Molecular Weight | 540.80 g/mol |
| Exact Mass | 540.42 |
| IUPAC Name | 2-[4,5-dimethyl-1-(3-methylbutyl)-3-(2-phenylethyl)imidazol-1-ium-2-yl]-4,5-dimethyl-1-(3-methylbutyl)-3-(2-phenylethyl)imidazol-1-ium |
| SMILES | CC1=C([N+](=C(N1CCC2=CC=CC=C2)C3=[N+](C(=C(N3CCC4=CC=CC=C4)C)C)CCC(C)C)CCC(C)C)C |
| InChI | InChI=1S/C36H52N4/c1-27(2)19-23-37-29(5)31(7)39(25-21-33-15-11-9-12-16-33)35(37)36-38(24-20-28(3)4)30(6)32(8)40(36)26-22-34-17-13-10-14-18-34/h9-18,27-28H,19-26H2,1-8H3/q+2 |
| InChIKey | TUYDOZLOJGQRQJ-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 17.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | 652 |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.80 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze Paenidigyamycin A with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Paenidigyamycin A?
The IUPAC name of Paenidigyamycin A (CID 146682879) is 2-[4,5-dimethyl-1-(3-methylbutyl)-3-(2-phenylethyl)imidazol-1-ium-2-yl]-4,5-dimethyl-1-(3-methylbutyl)-3-(2-phenylethyl)imidazol-1-ium.
What is the SMILES notation for Paenidigyamycin A?
The canonical SMILES for Paenidigyamycin A is CC1=C([N+](=C(N1CCC2=CC=CC=C2)C3=[N+](C(=C(N3CCC4=CC=CC=C4)C)C)CCC(C)C)CCC(C)C)C.
What is the InChIKey of Paenidigyamycin A?
The InChIKey is TUYDOZLOJGQRQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H52N4/c1-27(2)19-23-37-29(5)31(7)39(25-21-33-15-11-9-12-16-33)35(37)36-38(24-20-28(3)4)30(6)32(8)40(36)26-22-34-17-13-10-14-18-34/h9-18,27-28H,19-26H2,1-8H3/q+2.
What are the key properties of Paenidigyamycin A?
Paenidigyamycin A has a molecular weight of 540.80 g/mol, XLogP of 8.70, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Paenidigyamycin A is sourced from PubChem (CID 146682879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).