C23H30O4 — CID 146682947
(6aR,8R,9aR)-3-[(5S)-3,5-dimethylhepta-1,3-dienyl]-8-methoxy-6a,8-dimethyl-9,9a-dihydrofuro[2,3-h]isochromen-6-one (PubChem CID 146682947) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is (6aR,8R,9aR)-3-[(5S)-3,5-dimethylhepta-1,3-dienyl]-8-methoxy-6a,8-dimethyl-9,9a-dihydrofuro[2,3-h]isochromen-6-one.
| Compound Name | (6aR,8R,9aR)-3-[(5S)-3,5-dimethylhepta-1,3-dienyl]-8-methoxy-6a,8-dimethyl-9,9a-dihydrofuro[2,3-h]isochromen-6-one |
|---|---|
| PubChem CID | 146682947 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (6aR,8R,9aR)-3-[(5S)-3,5-dimethylhepta-1,3-dienyl]-8-methoxy-6a,8-dimethyl-9,9a-dihydrofuro[2,3-h]isochromen-6-one |
| SMILES | CC[C@H](C)C=C(C)C=CC1=CC2=CC(=O)[C@]3(C)O[C@@](C)(OC)C[C@@H]3C2=CO1 |
| InChI | InChI=1S/C23H30O4/c1-7-15(2)10-16(3)8-9-18-11-17-12-21(24)23(5)20(19(17)14-26-18)13-22(4,25-6)27-23/h8-12,14-15,20H,7,13H2,1-6H3/t15-,20+,22+,23+/m0/s1 |
| InChIKey | KRMNXAJBNOFESN-APQCTARYSA-N |
| XLogP | 5.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|