C19H19NO3 — CID 146683000
(2R,3S,6R)-4-(hydroxymethyl)-3,6-dimethyl-9-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(8),4,9-trien-12-one (PubChem CID 146683000) has the molecular formula C19H19NO3 and a molecular weight of 309.36 g/mol. Its IUPAC name is (2R,3S,6R)-4-(hydroxymethyl)-3,6-dimethyl-9-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(8),4,9-trien-12-one.
| Compound Name | (2R,3S,6R)-4-(hydroxymethyl)-3,6-dimethyl-9-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(8),4,9-trien-12-one |
|---|---|
| PubChem CID | 146683000 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (2R,3S,6R)-4-(hydroxymethyl)-3,6-dimethyl-9-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(8),4,9-trien-12-one |
| SMILES | C[C@@H]1C(CO)=C[C@@]2(C)Oc3c(-c4ccccc4)c[nH]c(=O)c3[C@@H]12 |
| InChI | InChI=1S/C19H19NO3/c1-11-13(10-21)8-19(2)16(11)15-17(23-19)14(9-20-18(15)22)12-6-4-3-5-7-12/h3-9,11,16,21H,10H2,1-2H3,(H,20,22)/t11-,16-,19-/m1/s1 |
| InChIKey | QVWZGMSQOPIXBC-CYXMAGCYSA-N |
| XLogP | 2.85 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|