About (5Z)-5-[(2S,3S)-2,3-dihydroxybutylidene]-3-propylfuran-2-one
(5Z)-5-[(2S,3S)-2,3-dihydroxybutylidene]-3-propylfuran-2-one (PubChem CID 146683020) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is (5Z)-5-[(2S,3S)-2,3-dihydroxybutylidene]-3-propylfuran-2-one.
Molecular Properties
| Compound Name | (5Z)-5-[(2S,3S)-2,3-dihydroxybutylidene]-3-propylfuran-2-one |
| PubChem CID | 146683020 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (5Z)-5-[(2S,3S)-2,3-dihydroxybutylidene]-3-propylfuran-2-one |
| SMILES | CCCC1=C/C(=C/[C@H](O)[C@H](C)O)OC1=O |
| InChI | InChI=1S/C11H16O4/c1-3-4-8-5-9(15-11(8)14)6-10(13)7(2)12/h5-7,10,12-13H,3-4H2,1-2H3/b9-6-/t7-,10-/m0/s1 |
| InChIKey | UBKACRCUIDSXLA-UAADGWBESA-N |
| XLogP | 0.90 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5Z)-5-[(2S,3S)-2,3-dihydroxybutylidene]-3-propylfuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-[(2S,3S)-2,3-dihydroxybutylidene]-3-propylfuran-2-one?
The IUPAC name of (5Z)-5-[(2S,3S)-2,3-dihydroxybutylidene]-3-propylfuran-2-one (CID 146683020) is (5Z)-5-[(2S,3S)-2,3-dihydroxybutylidene]-3-propylfuran-2-one.
What is the SMILES notation for (5Z)-5-[(2S,3S)-2,3-dihydroxybutylidene]-3-propylfuran-2-one?
The canonical SMILES for (5Z)-5-[(2S,3S)-2,3-dihydroxybutylidene]-3-propylfuran-2-one is CCCC1=C/C(=C/[C@H](O)[C@H](C)O)OC1=O.
What is the InChIKey of (5Z)-5-[(2S,3S)-2,3-dihydroxybutylidene]-3-propylfuran-2-one?
The InChIKey is UBKACRCUIDSXLA-UAADGWBESA-N. The full InChI is InChI=1S/C11H16O4/c1-3-4-8-5-9(15-11(8)14)6-10(13)7(2)12/h5-7,10,12-13H,3-4H2,1-2H3/b9-6-/t7-,10-/m0/s1.
What are the key properties of (5Z)-5-[(2S,3S)-2,3-dihydroxybutylidene]-3-propylfuran-2-one?
(5Z)-5-[(2S,3S)-2,3-dihydroxybutylidene]-3-propylfuran-2-one has a molecular weight of 212.24 g/mol, XLogP of 0.90, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-[(2S,3S)-2,3-dihydroxybutylidene]-3-propylfuran-2-one is sourced from PubChem (CID 146683020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).