C15H24O5 — CID 146683056
(1S,4R,5S,8R,9R)-8-hydroxy-4-(2-hydroxypropan-2-yl)-10-oxatricyclo[7.2.1.01,5]dodecane-8-carboxylic acid (PubChem CID 146683056) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (1S,4R,5S,8R,9R)-8-hydroxy-4-(2-hydroxypropan-2-yl)-10-oxatricyclo[7.2.1.01,5]dodecane-8-carboxylic acid.
| Compound Name | (1S,4R,5S,8R,9R)-8-hydroxy-4-(2-hydroxypropan-2-yl)-10-oxatricyclo[7.2.1.01,5]dodecane-8-carboxylic acid |
|---|---|
| PubChem CID | 146683056 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (1S,4R,5S,8R,9R)-8-hydroxy-4-(2-hydroxypropan-2-yl)-10-oxatricyclo[7.2.1.01,5]dodecane-8-carboxylic acid |
| SMILES | CC(C)(O)[C@@H]1CC[C@]23CO[C@H](C2)[C@@](O)(C(=O)O)CC[C@@H]13 |
| InChI | InChI=1S/C15H24O5/c1-13(2,18)9-3-5-14-7-11(20-8-14)15(19,12(16)17)6-4-10(9)14/h9-11,18-19H,3-8H2,1-2H3,(H,16,17)/t9-,10+,11-,14-,15-/m1/s1 |
| InChIKey | HAYWOURFBUULOE-SPSJUYOASA-N |
| XLogP | 1.17 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |