C10H16O4 — CID 146683066
(3R,3aS,4R,5S,6aR)-3,5-dihydroxy-3,4,5-trimethyl-3a,4,6,6a-tetrahydrocyclopenta[b]furan-2-one (PubChem CID 146683066) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (3R,3aS,4R,5S,6aR)-3,5-dihydroxy-3,4,5-trimethyl-3a,4,6,6a-tetrahydrocyclopenta[b]furan-2-one.
| Compound Name | (3R,3aS,4R,5S,6aR)-3,5-dihydroxy-3,4,5-trimethyl-3a,4,6,6a-tetrahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 146683066 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (3R,3aS,4R,5S,6aR)-3,5-dihydroxy-3,4,5-trimethyl-3a,4,6,6a-tetrahydrocyclopenta[b]furan-2-one |
| SMILES | C[C@@H]1[C@H]2[C@@H](C[C@]1(C)O)OC(=O)[C@]2(C)O |
| InChI | InChI=1S/C10H16O4/c1-5-7-6(4-9(5,2)12)14-8(11)10(7,3)13/h5-7,12-13H,4H2,1-3H3/t5-,6-,7+,9+,10-/m1/s1 |
| InChIKey | ORCDXOHZCRZPRS-FOWOUKQUSA-N |
| XLogP | 0.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |