C16H22O4 — CID 146683117
(4aS,8S,10S,10aS,10bR)-10-hydroxy-8-(hydroxymethyl)-4a,10b-dimethyl-2,3,8,9,10,10a-hexahydrobenzo[f]chromen-1-one (PubChem CID 146683117) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (4aS,8S,10S,10aS,10bR)-10-hydroxy-8-(hydroxymethyl)-4a,10b-dimethyl-2,3,8,9,10,10a-hexahydrobenzo[f]chromen-1-one.
| Compound Name | (4aS,8S,10S,10aS,10bR)-10-hydroxy-8-(hydroxymethyl)-4a,10b-dimethyl-2,3,8,9,10,10a-hexahydrobenzo[f]chromen-1-one |
|---|---|
| PubChem CID | 146683117 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (4aS,8S,10S,10aS,10bR)-10-hydroxy-8-(hydroxymethyl)-4a,10b-dimethyl-2,3,8,9,10,10a-hexahydrobenzo[f]chromen-1-one |
| SMILES | C[C@]12C=CC3=C[C@@H](CO)C[C@H](O)[C@@H]3[C@@]1(C)C(=O)CCO2 |
| InChI | InChI=1S/C16H22O4/c1-15-5-3-11-7-10(9-17)8-12(18)14(11)16(15,2)13(19)4-6-20-15/h3,5,7,10,12,14,17-18H,4,6,8-9H2,1-2H3/t10-,12+,14-,15+,16-/m1/s1 |
| InChIKey | ARJXSLHALKAJPV-ZZIHQOKHSA-N |
| XLogP | 1.23 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |