C16H22O4 — CID 146683118
(4aS,8R,9S,10R,10aS,10bR)-9,10-dihydroxy-4a,8,10b-trimethyl-2,3,8,9,10,10a-hexahydrobenzo[f]chromen-1-one (PubChem CID 146683118) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (4aS,8R,9S,10R,10aS,10bR)-9,10-dihydroxy-4a,8,10b-trimethyl-2,3,8,9,10,10a-hexahydrobenzo[f]chromen-1-one.
| Compound Name | (4aS,8R,9S,10R,10aS,10bR)-9,10-dihydroxy-4a,8,10b-trimethyl-2,3,8,9,10,10a-hexahydrobenzo[f]chromen-1-one |
|---|---|
| PubChem CID | 146683118 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (4aS,8R,9S,10R,10aS,10bR)-9,10-dihydroxy-4a,8,10b-trimethyl-2,3,8,9,10,10a-hexahydrobenzo[f]chromen-1-one |
| SMILES | C[C@@H]1C=C2C=C[C@]3(C)OCCC(=O)[C@]3(C)[C@H]2[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H22O4/c1-9-8-10-4-6-15(2)16(3,11(17)5-7-20-15)12(10)14(19)13(9)18/h4,6,8-9,12-14,18-19H,5,7H2,1-3H3/t9-,12-,13+,14-,15+,16-/m1/s1 |
| InChIKey | OIHNLYQDQZSUTR-HIMXQRAGSA-N |
| XLogP | 1.22 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |