C19H27NO8 — CID 146683126
(1R,3S,4S,7R,8R,11R,12S,13R)-11-methoxy-8-(4-methoxyphenyl)-6-methyl-2,9,14-trioxa-6-azatricyclo[9.2.1.03,7]tetradecane-4,12,13-triol (PubChem CID 146683126) has the molecular formula C19H27NO8 and a molecular weight of 397.42 g/mol. Its IUPAC name is (1R,3S,4S,7R,8R,11R,12S,13R)-11-methoxy-8-(4-methoxyphenyl)-6-methyl-2,9,14-trioxa-6-azatricyclo[9.2.1.03,7]tetradecane-4,12,13-triol.
| Compound Name | (1R,3S,4S,7R,8R,11R,12S,13R)-11-methoxy-8-(4-methoxyphenyl)-6-methyl-2,9,14-trioxa-6-azatricyclo[9.2.1.03,7]tetradecane-4,12,13-triol |
|---|---|
| PubChem CID | 146683126 |
| Molecular Formula | C19H27NO8 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (1R,3S,4S,7R,8R,11R,12S,13R)-11-methoxy-8-(4-methoxyphenyl)-6-methyl-2,9,14-trioxa-6-azatricyclo[9.2.1.03,7]tetradecane-4,12,13-triol |
| SMILES | COc1ccc([C@H]2OC[C@@]3(OC)O[C@@H](O[C@H]4[C@@H]2N(C)C[C@@H]4O)[C@H](O)[C@@H]3O)cc1 |
| InChI | InChI=1S/C19H27NO8/c1-20-8-12(21)16-13(20)15(10-4-6-11(24-2)7-5-10)26-9-19(25-3)17(23)14(22)18(27-16)28-19/h4-7,12-18,21-23H,8-9H2,1-3H3/t12-,13+,14+,15+,16+,17-,18+,19+/m0/s1 |
| InChIKey | FDEPWMBMISZARC-DWLZBLENSA-N |
| XLogP | -0.75 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |