C27H33NO3 — CID 146683174
(3Z,5E,12R,15E,17Z,19Z,21E,23Z,25R)-12-hydroxy-9,25-dimethyl-1-azacyclohexacosa-3,5,7,9,15,17,19,21,23-nonaene-2,14-dione (PubChem CID 146683174) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is (3Z,5E,12R,15E,17Z,19Z,21E,23Z,25R)-12-hydroxy-9,25-dimethyl-1-azacyclohexacosa-3,5,7,9,15,17,19,21,23-nonaene-2,14-dione.
| Compound Name | (3Z,5E,12R,15E,17Z,19Z,21E,23Z,25R)-12-hydroxy-9,25-dimethyl-1-azacyclohexacosa-3,5,7,9,15,17,19,21,23-nonaene-2,14-dione |
|---|---|
| PubChem CID | 146683174 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | (3Z,5E,12R,15E,17Z,19Z,21E,23Z,25R)-12-hydroxy-9,25-dimethyl-1-azacyclohexacosa-3,5,7,9,15,17,19,21,23-nonaene-2,14-dione |
| SMILES | CC1=CC[C@@H](O)CC(=O)/C=C/C=C\C=C/C=C/C=C\[C@@H](C)CNC(=O)/C=C\C=C\C=C1 |
| InChI | InChI=1S/C27H33NO3/c1-23-15-11-9-10-14-18-27(31)28-22-24(2)16-12-7-5-3-4-6-8-13-17-25(29)21-26(30)20-19-23/h3-19,24,26,30H,20-22H2,1-2H3,(H,28,31)/b4-3-,7-5+,8-6-,10-9+,15-11?,16-12-,17-13+,18-14-,23-19?/t24-,26-/m1/s1 |
| InChIKey | NCLKPTJQVKBQEN-YBNREDKZSA-N |
| XLogP | 4.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |