C20H32O4 — CID 146683196
(1aR,2S,4aR,7R,8aS)-4-ethyl-3-hept-1-enyl-6,6-dimethyl-2,4a,7,8-tetrahydro-1aH-oxireno[2,3-e]chromene-2,7-diol (PubChem CID 146683196) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (1aR,2S,4aR,7R,8aS)-4-ethyl-3-hept-1-enyl-6,6-dimethyl-2,4a,7,8-tetrahydro-1aH-oxireno[2,3-e]chromene-2,7-diol.
| Compound Name | (1aR,2S,4aR,7R,8aS)-4-ethyl-3-hept-1-enyl-6,6-dimethyl-2,4a,7,8-tetrahydro-1aH-oxireno[2,3-e]chromene-2,7-diol |
|---|---|
| PubChem CID | 146683196 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (1aR,2S,4aR,7R,8aS)-4-ethyl-3-hept-1-enyl-6,6-dimethyl-2,4a,7,8-tetrahydro-1aH-oxireno[2,3-e]chromene-2,7-diol |
| SMILES | CCCCCC=CC1=C(CC)[C@H]2OC(C)(C)[C@H](O)C[C@]23O[C@@H]3[C@H]1O |
| InChI | InChI=1S/C20H32O4/c1-5-7-8-9-10-11-14-13(6-2)17-20(18(24-20)16(14)22)12-15(21)19(3,4)23-17/h10-11,15-18,21-22H,5-9,12H2,1-4H3/t15-,16+,17-,18-,20+/m1/s1 |
| InChIKey | RPEQSKPEWZMDDW-LYYGHALDSA-N |
| XLogP | 3.27 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|