C20H25NO2 — CID 146683209
(10R,19S)-10-hydroxy-19-methyl-1-azacycloicosa-3,5,7,11,13,15,17-heptaen-2-one (PubChem CID 146683209) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is (10R,19S)-10-hydroxy-19-methyl-1-azacycloicosa-3,5,7,11,13,15,17-heptaen-2-one.
| Compound Name | (10R,19S)-10-hydroxy-19-methyl-1-azacycloicosa-3,5,7,11,13,15,17-heptaen-2-one |
|---|---|
| PubChem CID | 146683209 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (10R,19S)-10-hydroxy-19-methyl-1-azacycloicosa-3,5,7,11,13,15,17-heptaen-2-one |
| SMILES | C[C@H]1C=CC=CC=CC=C[C@H](O)CC=CC=CC=CC(=O)NC1 |
| InChI | InChI=1S/C20H25NO2/c1-18-13-9-5-2-3-6-10-14-19(22)15-11-7-4-8-12-16-20(23)21-17-18/h2-14,16,18-19,22H,15,17H2,1H3,(H,21,23)/t18-,19-/m0/s1 |
| InChIKey | ZGISRQDECHVCPS-OALUTQOASA-N |
| XLogP | 3.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |