C14H18O4 — CID 146683305
3-[(2S,3S)-3-methyl-6-oxo-2-[(1E,3E)-penta-1,3-dienyl]-2,3-dihydropyran-5-yl]propanoic acid (PubChem CID 146683305) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 3-[(2S,3S)-3-methyl-6-oxo-2-[(1E,3E)-penta-1,3-dienyl]-2,3-dihydropyran-5-yl]propanoic acid.
| Compound Name | 3-[(2S,3S)-3-methyl-6-oxo-2-[(1E,3E)-penta-1,3-dienyl]-2,3-dihydropyran-5-yl]propanoic acid |
|---|---|
| PubChem CID | 146683305 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 3-[(2S,3S)-3-methyl-6-oxo-2-[(1E,3E)-penta-1,3-dienyl]-2,3-dihydropyran-5-yl]propanoic acid |
| SMILES | C/C=C/C=C/[C@@H]1OC(=O)C(CCC(=O)O)=C[C@@H]1C |
| InChI | InChI=1S/C14H18O4/c1-3-4-5-6-12-10(2)9-11(14(17)18-12)7-8-13(15)16/h3-6,9-10,12H,7-8H2,1-2H3,(H,15,16)/b4-3+,6-5+/t10-,12-/m0/s1 |
| InChIKey | HOICLNORVYVWEJ-VEAKIABCSA-N |
| XLogP | 2.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|