C14H16O6 — CID 146683307
(2E,4E)-5-[(2S,3S)-5-(2-carboxyethyl)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]penta-2,4-dienoic acid (PubChem CID 146683307) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is (2E,4E)-5-[(2S,3S)-5-(2-carboxyethyl)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[(2S,3S)-5-(2-carboxyethyl)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 146683307 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (2E,4E)-5-[(2S,3S)-5-(2-carboxyethyl)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]penta-2,4-dienoic acid |
| SMILES | C[C@H]1C=C(CCC(=O)O)C(=O)O[C@H]1/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C14H16O6/c1-9-8-10(6-7-13(17)18)14(19)20-11(9)4-2-3-5-12(15)16/h2-5,8-9,11H,6-7H2,1H3,(H,15,16)(H,17,18)/b4-2+,5-3+/t9-,11-/m0/s1 |
| InChIKey | KVPQGNJRYLOXMG-RUVHQKKISA-N |
| XLogP | 1.54 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|