C21H34O5 — CID 146683343
(1S,2R,5S,7R,10R,12R,13R,14R)-13-(hydroxymethyl)-7-methoxy-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadec-8-ene-1,14-diol (PubChem CID 146683343) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is (1S,2R,5S,7R,10R,12R,13R,14R)-13-(hydroxymethyl)-7-methoxy-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadec-8-ene-1,14-diol.
| Compound Name | (1S,2R,5S,7R,10R,12R,13R,14R)-13-(hydroxymethyl)-7-methoxy-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadec-8-ene-1,14-diol |
|---|---|
| PubChem CID | 146683343 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | (1S,2R,5S,7R,10R,12R,13R,14R)-13-(hydroxymethyl)-7-methoxy-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadec-8-ene-1,14-diol |
| SMILES | CO[C@@H]1C[C@]2(C)CC[C@]3(C)[C@H](C[C@H]4O[C@]3(O)[C@H](O)[C@H]4CO)C2=C1C(C)C |
| InChI | InChI=1S/C21H34O5/c1-11(2)16-15(25-5)9-19(3)6-7-20(4)13(17(16)19)8-14-12(10-22)18(23)21(20,24)26-14/h11-15,18,22-24H,6-10H2,1-5H3/t12-,13+,14+,15+,18+,19-,20+,21+/m0/s1 |
| InChIKey | LNOVVADOOMBUOP-OBGSZASISA-N |
| XLogP | 2.24 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|