C15H20O4 — CID 146683351
(5R)-5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-propylfuran-3-carboxylic acid (PubChem CID 146683351) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (5R)-5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-propylfuran-3-carboxylic acid.
| Compound Name | (5R)-5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-propylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 146683351 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (5R)-5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-propylfuran-3-carboxylic acid |
| SMILES | CC/C=C/C=C/[C@@]1(C)OC(CCC)=C(C(=O)O)C1=O |
| InChI | InChI=1S/C15H20O4/c1-4-6-7-8-10-15(3)13(16)12(14(17)18)11(19-15)9-5-2/h6-8,10H,4-5,9H2,1-3H3,(H,17,18)/b7-6+,10-8+/t15-/m1/s1 |
| InChIKey | DYPILKLQLBTLGV-GMYOSPGMSA-N |
| XLogP | 3.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|